C29H35N7O — CID 159190451
5-[(2R,6S)-2-methyl-6-[[4-[(7S)-7-methyl-5,6,7,8-tetrahydro-2,6-naphthyridin-3-yl]piperazin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile (PubChem CID 159190451) has the molecular formula C29H35N7O and a molecular weight of 497.65 g/mol. Its IUPAC name is 5-[(2R,6S)-2-methyl-6-[[4-[(7S)-7-methyl-5,6,7,8-tetrahydro-2,6-naphthyridin-3-yl]piperazin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(2R,6S)-2-methyl-6-[[4-[(7S)-7-methyl-5,6,7,8-tetrahydro-2,6-naphthyridin-3-yl]piperazin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 159190451 |
| Molecular Formula | C29H35N7O |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 5-[(2R,6S)-2-methyl-6-[[4-[(7S)-7-methyl-5,6,7,8-tetrahydro-2,6-naphthyridin-3-yl]piperazin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@H](CN2CCN(c3cc4c(cn3)C[C@H](C)NC4)CC2)O1 |
| InChI | InChI=1S/C29H35N7O/c1-20-12-23-16-33-28(13-24(23)15-32-20)35-10-8-34(9-11-35)18-25-19-36(17-21(2)37-25)27-6-5-22(14-30)29-26(27)4-3-7-31-29/h3-7,13,16,20-21,25,32H,8-12,15,17-19H2,1-2H3/t20-,21+,25-/m0/s1 |
| InChIKey | KOACSZUGTWKSAL-BKSPAHHJSA-N |
| XLogP | 2.95 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |