C30H39N7O3 — CID 146443011
tert-butyl 4-[4-[[[(2S,6R)-4-(7-cyanopyrazolo[1,5-a]pyridin-4-yl)-6-methylmorpholin-2-yl]methylamino]methyl]phenyl]piperazine-1-carboxylate (PubChem CID 146443011) has the molecular formula C30H39N7O3 and a molecular weight of 545.69 g/mol. Its IUPAC name is tert-butyl 4-[4-[[[(2S,6R)-4-(7-cyanopyrazolo[1,5-a]pyridin-4-yl)-6-methylmorpholin-2-yl]methylamino]methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[[(2S,6R)-4-(7-cyanopyrazolo[1,5-a]pyridin-4-yl)-6-methylmorpholin-2-yl]methylamino]methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146443011 |
| Molecular Formula | C30H39N7O3 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | tert-butyl 4-[4-[[[(2S,6R)-4-(7-cyanopyrazolo[1,5-a]pyridin-4-yl)-6-methylmorpholin-2-yl]methylamino]methyl]phenyl]piperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2ccc(C#N)n3nccc23)C[C@H](CNCc2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)O1 |
| InChI | InChI=1S/C30H39N7O3/c1-22-20-36(27-10-9-25(17-31)37-28(27)11-12-33-37)21-26(39-22)19-32-18-23-5-7-24(8-6-23)34-13-15-35(16-14-34)29(38)40-30(2,3)4/h5-12,22,26,32H,13-16,18-21H2,1-4H3/t22-,26+/m1/s1 |
| InChIKey | LHCQOWUYWGNQCG-GJZUVCINSA-N |
| XLogP | 3.65 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|