C12H10BrN3OS — CID 146443765
5-(5-bromo-3-ethyl-1H-indol-2-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 146443765) has the molecular formula C12H10BrN3OS and a molecular weight of 324.20 g/mol. Its IUPAC name is 5-(5-bromo-3-ethyl-1H-indol-2-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(5-bromo-3-ethyl-1H-indol-2-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 146443765 |
| Molecular Formula | C12H10BrN3OS |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | 5-(5-bromo-3-ethyl-1H-indol-2-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CCc1c(-c2n[nH]c(=S)o2)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C12H10BrN3OS/c1-2-7-8-5-6(13)3-4-9(8)14-10(7)11-15-16-12(18)17-11/h3-5,14H,2H2,1H3,(H,16,18) |
| InChIKey | OXDWFVPMFDGITO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|