C19H32N4O4S — CID 146446093
3-(3-methylsulfonylpropoxy)-1-[4-[(1S,5R)-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]cyclohexyl]pyrazol-4-amine (PubChem CID 146446093) has the molecular formula C19H32N4O4S and a molecular weight of 412.56 g/mol. Its IUPAC name is 3-(3-methylsulfonylpropoxy)-1-[4-[(1S,5R)-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]cyclohexyl]pyrazol-4-amine.
| Compound Name | 3-(3-methylsulfonylpropoxy)-1-[4-[(1S,5R)-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]cyclohexyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 146446093 |
| Molecular Formula | C19H32N4O4S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-(3-methylsulfonylpropoxy)-1-[4-[(1S,5R)-3-oxa-8-azabicyclo[3.2.1]octan-8-yl]cyclohexyl]pyrazol-4-amine |
| SMILES | CS(=O)(=O)CCCOc1nn(C2CCC(N3[C@@H]4CC[C@H]3COC4)CC2)cc1N |
| InChI | InChI=1S/C19H32N4O4S/c1-28(24,25)10-2-9-27-19-18(20)11-22(21-19)14-3-5-15(6-4-14)23-16-7-8-17(23)13-26-12-16/h11,14-17H,2-10,12-13,20H2,1H3/t14?,15?,16-,17+ |
| InChIKey | UKTJOIKDMAUZBU-UCUFBTAOSA-N |
| XLogP | 1.63 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|