C6H8ClN3O — CID 165398729
3-chloro-1-(oxetan-3-yl)pyrazol-4-amine (PubChem CID 165398729) has the molecular formula C6H8ClN3O and a molecular weight of 173.60 g/mol. Its IUPAC name is 3-chloro-1-(oxetan-3-yl)pyrazol-4-amine.
| Compound Name | 3-chloro-1-(oxetan-3-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 165398729 |
| Molecular Formula | C6H8ClN3O |
| Molecular Weight | 173.60 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | 3-chloro-1-(oxetan-3-yl)pyrazol-4-amine |
| SMILES | Nc1cn(C2COC2)nc1Cl |
| InChI | InChI=1S/C6H8ClN3O/c7-6-5(8)1-10(9-6)4-2-11-3-4/h1,4H,2-3,8H2 |
| InChIKey | ILAQBHGVAAOFAW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.60 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |