C28H31FN4O3 — CID 146447182
4-[2-(3-fluoropropylamino)-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]ethyl]-5-hydroxy-1H-pyrimidin-6-one (PubChem CID 146447182) has the molecular formula C28H31FN4O3 and a molecular weight of 490.58 g/mol. Its IUPAC name is 4-[2-(3-fluoropropylamino)-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]ethyl]-5-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(3-fluoropropylamino)-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]ethyl]-5-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 146447182 |
| Molecular Formula | C28H31FN4O3 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 4-[2-(3-fluoropropylamino)-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]ethyl]-5-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(CC(NCCCF)c2ccc(C#Cc3ccc(CN4CCOCC4)cc3)cc2)c1O |
| InChI | InChI=1S/C28H31FN4O3/c29-12-1-13-30-25(18-26-27(34)28(35)32-20-31-26)24-10-8-22(9-11-24)3-2-21-4-6-23(7-5-21)19-33-14-16-36-17-15-33/h4-11,20,25,30,34H,1,12-19H2,(H,31,32,35) |
| InChIKey | PMEBTPNPRDLZSO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|