C29H32F2N4O3 — CID 146447417
4-[(2S)-2-[2-fluoro-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]-3-(3-fluoropropylamino)propyl]-5-hydroxy-1H-pyrimidin-6-one (PubChem CID 146447417) has the molecular formula C29H32F2N4O3 and a molecular weight of 522.60 g/mol. Its IUPAC name is 4-[(2S)-2-[2-fluoro-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]-3-(3-fluoropropylamino)propyl]-5-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 4-[(2S)-2-[2-fluoro-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]-3-(3-fluoropropylamino)propyl]-5-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 146447417 |
| Molecular Formula | C29H32F2N4O3 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 4-[(2S)-2-[2-fluoro-4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]-3-(3-fluoropropylamino)propyl]-5-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(C[C@H](CNCCCF)c2ccc(C#Cc3ccc(CN4CCOCC4)cc3)cc2F)c1O |
| InChI | InChI=1S/C29H32F2N4O3/c30-10-1-11-32-18-24(17-27-28(36)29(37)34-20-33-27)25-9-8-22(16-26(25)31)5-2-21-3-6-23(7-4-21)19-35-12-14-38-15-13-35/h3-4,6-9,16,20,24,32,36H,1,10-15,17-19H2,(H,33,34,37)/t24-/m1/s1 |
| InChIKey | DZTCFPJFWLOPJK-XMMPIXPASA-N |
| XLogP | 3.12 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|