C27H30FN5O3 — CID 146617392
4-[1-(2-fluoroethylamino)-3-[4-[2-[5-(morpholin-4-ylmethyl)-2-pyridinyl]ethynyl]phenyl]propan-2-yl]-5-hydroxy-1H-pyrimidin-6-one (PubChem CID 146617392) has the molecular formula C27H30FN5O3 and a molecular weight of 491.57 g/mol. Its IUPAC name is 4-[1-(2-fluoroethylamino)-3-[4-[2-[5-(morpholin-4-ylmethyl)-2-pyridinyl]ethynyl]phenyl]propan-2-yl]-5-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 4-[1-(2-fluoroethylamino)-3-[4-[2-[5-(morpholin-4-ylmethyl)-2-pyridinyl]ethynyl]phenyl]propan-2-yl]-5-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 146617392 |
| Molecular Formula | C27H30FN5O3 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 4-[1-(2-fluoroethylamino)-3-[4-[2-[5-(morpholin-4-ylmethyl)-2-pyridinyl]ethynyl]phenyl]propan-2-yl]-5-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(C(CNCCF)Cc2ccc(C#Cc3ccc(CN4CCOCC4)cn3)cc2)c1O |
| InChI | InChI=1S/C27H30FN5O3/c28-9-10-29-17-23(25-26(34)27(35)32-19-31-25)15-21-3-1-20(2-4-21)5-7-24-8-6-22(16-30-24)18-33-11-13-36-14-12-33/h1-4,6,8,16,19,23,29,34H,9-15,17-18H2,(H,31,32,35) |
| InChIKey | CPTQNOXFTKPNRJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|