C9H12N2O4 — CID 14644804
2-(1,3,4-trimethyl-2,6-dioxopyrimidin-5-yl)acetic acid (PubChem CID 14644804) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-(1,3,4-trimethyl-2,6-dioxopyrimidin-5-yl)acetic acid.
| Compound Name | 2-(1,3,4-trimethyl-2,6-dioxopyrimidin-5-yl)acetic acid |
|---|---|
| PubChem CID | 14644804 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-(1,3,4-trimethyl-2,6-dioxopyrimidin-5-yl)acetic acid |
| SMILES | Cc1c(CC(=O)O)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C9H12N2O4/c1-5-6(4-7(12)13)8(14)11(3)9(15)10(5)2/h4H2,1-3H3,(H,12,13) |
| InChIKey | LCGHMUHZVANHGI-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |