C13H15NO2 — CID 146448332
N-[1-(1-benzofuran-3-yl)butan-2-yl]formamide (PubChem CID 146448332) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is N-[1-(1-benzofuran-3-yl)butan-2-yl]formamide.
| Compound Name | N-[1-(1-benzofuran-3-yl)butan-2-yl]formamide |
|---|---|
| PubChem CID | 146448332 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-[1-(1-benzofuran-3-yl)butan-2-yl]formamide |
| SMILES | CCC(Cc1coc2ccccc12)NC=O |
| InChI | InChI=1S/C13H15NO2/c1-2-11(14-9-15)7-10-8-16-13-6-4-3-5-12(10)13/h3-6,8-9,11H,2,7H2,1H3,(H,14,15) |
| InChIKey | RNSJPCNGCMIMJV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|