C21H32Cl2N6O3 — CID 146448775
(5-methyl-2-phenylpyrazol-3-yl) 4-[(2S)-2,6-diaminohexanoyl]piperazine-1-carboxylate;dihydrochloride (PubChem CID 146448775) has the molecular formula C21H32Cl2N6O3 and a molecular weight of 487.43 g/mol. Its IUPAC name is (5-methyl-2-phenylpyrazol-3-yl) 4-[(2S)-2,6-diaminohexanoyl]piperazine-1-carboxylate;dihydrochloride.
| Compound Name | (5-methyl-2-phenylpyrazol-3-yl) 4-[(2S)-2,6-diaminohexanoyl]piperazine-1-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 146448775 |
| Molecular Formula | C21H32Cl2N6O3 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (5-methyl-2-phenylpyrazol-3-yl) 4-[(2S)-2,6-diaminohexanoyl]piperazine-1-carboxylate;dihydrochloride |
| SMILES | Cc1cc(OC(=O)N2CCN(C(=O)[C@@H](N)CCCCN)CC2)n(-c2ccccc2)n1.Cl.Cl |
| InChI | InChI=1S/C21H30N6O3.2ClH/c1-16-15-19(27(24-16)17-7-3-2-4-8-17)30-21(29)26-13-11-25(12-14-26)20(28)18(23)9-5-6-10-22;;/h2-4,7-8,15,18H,5-6,9-14,22-23H2,1H3;2*1H/t18-;;/m0../s1 |
| InChIKey | WFNXASKLJRDWQC-NTEVMMBTSA-N |
| XLogP | 2.12 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|