C21H32Cl2N4OS — CID 166600286
(2S)-2,6-diamino-1-[4-(2-methyl-1,3-thiazol-4-yl)-4-phenylpiperidin-1-yl]hexan-1-one;dihydrochloride (PubChem CID 166600286) has the molecular formula C21H32Cl2N4OS and a molecular weight of 459.49 g/mol. Its IUPAC name is (2S)-2,6-diamino-1-[4-(2-methyl-1,3-thiazol-4-yl)-4-phenylpiperidin-1-yl]hexan-1-one;dihydrochloride.
| Compound Name | (2S)-2,6-diamino-1-[4-(2-methyl-1,3-thiazol-4-yl)-4-phenylpiperidin-1-yl]hexan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 166600286 |
| Molecular Formula | C21H32Cl2N4OS |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (2S)-2,6-diamino-1-[4-(2-methyl-1,3-thiazol-4-yl)-4-phenylpiperidin-1-yl]hexan-1-one;dihydrochloride |
| SMILES | Cc1nc(C2(c3ccccc3)CCN(C(=O)[C@@H](N)CCCCN)CC2)cs1.Cl.Cl |
| InChI | InChI=1S/C21H30N4OS.2ClH/c1-16-24-19(15-27-16)21(17-7-3-2-4-8-17)10-13-25(14-11-21)20(26)18(23)9-5-6-12-22;;/h2-4,7-8,15,18H,5-6,9-14,22-23H2,1H3;2*1H/t18-;;/m0../s1 |
| InChIKey | HDNLXONXZPWBEF-NTEVMMBTSA-N |
| XLogP | 3.66 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|