C23H23N3O2S — CID 165420028
4-[4-(2-methyl-1,3-thiazol-4-yl)-4-phenylpiperidine-1-carbonyl]benzamide (PubChem CID 165420028) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 4-[4-(2-methyl-1,3-thiazol-4-yl)-4-phenylpiperidine-1-carbonyl]benzamide.
| Compound Name | 4-[4-(2-methyl-1,3-thiazol-4-yl)-4-phenylpiperidine-1-carbonyl]benzamide |
|---|---|
| PubChem CID | 165420028 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-[4-(2-methyl-1,3-thiazol-4-yl)-4-phenylpiperidine-1-carbonyl]benzamide |
| SMILES | Cc1nc(C2(c3ccccc3)CCN(C(=O)c3ccc(C(N)=O)cc3)CC2)cs1 |
| InChI | InChI=1S/C23H23N3O2S/c1-16-25-20(15-29-16)23(19-5-3-2-4-6-19)11-13-26(14-12-23)22(28)18-9-7-17(8-10-18)21(24)27/h2-10,15H,11-14H2,1H3,(H2,24,27) |
| InChIKey | BFFQZXDKPRCROL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |