C30H36N2O9S2 — CID 146449691
4-[4-[3-(3-methylpiperidin-1-yl)propoxy]phenyl]-1-oxidopyridin-1-ium;naphthalene-1,5-disulfonic acid;hydrate (PubChem CID 146449691) has the molecular formula C30H36N2O9S2 and a molecular weight of 632.76 g/mol. Its IUPAC name is 4-[4-[3-(3-methylpiperidin-1-yl)propoxy]phenyl]-1-oxidopyridin-1-ium;naphthalene-1,5-disulfonic acid;hydrate.
| Compound Name | 4-[4-[3-(3-methylpiperidin-1-yl)propoxy]phenyl]-1-oxidopyridin-1-ium;naphthalene-1,5-disulfonic acid;hydrate |
|---|---|
| PubChem CID | 146449691 |
| Molecular Formula | C30H36N2O9S2 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 4-[4-[3-(3-methylpiperidin-1-yl)propoxy]phenyl]-1-oxidopyridin-1-ium;naphthalene-1,5-disulfonic acid;hydrate |
| SMILES | CC1CCCN(CCCOc2ccc(-c3cc[n+]([O-])cc3)cc2)C1.O.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C20H26N2O2.C10H8O6S2.H2O/c1-17-4-2-11-21(16-17)12-3-15-24-20-7-5-18(6-8-20)19-9-13-22(23)14-10-19;11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;/h5-10,13-14,17H,2-4,11-12,15-16H2,1H3;1-6H,(H,11,12,13)(H,14,15,16);1H2 |
| InChIKey | CDXYWRGIFQAUEW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 179.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|