C15H20N2O4 — CID 146450241
3-[2-(tert-butylamino)-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxylic acid (PubChem CID 146450241) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-[2-(tert-butylamino)-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxylic acid.
| Compound Name | 3-[2-(tert-butylamino)-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxylic acid |
|---|---|
| PubChem CID | 146450241 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-[2-(tert-butylamino)-2-oxoacetyl]-5,6,7,8-tetrahydroindolizine-1-carboxylic acid |
| SMILES | CC(C)(C)NC(=O)C(=O)c1cc(C(=O)O)c2n1CCCC2 |
| InChI | InChI=1S/C15H20N2O4/c1-15(2,3)16-13(19)12(18)11-8-9(14(20)21)10-6-4-5-7-17(10)11/h8H,4-7H2,1-3H3,(H,16,19)(H,20,21) |
| InChIKey | MMVPFJPLKURTKE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|