C19H23ClN4O4 — CID 146450252
N-(2-chloro-4-pyridinyl)-5-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-oxoacetyl]-1,2,4-trimethylpyrrole-3-carboxamide (PubChem CID 146450252) has the molecular formula C19H23ClN4O4 and a molecular weight of 406.87 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-5-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-oxoacetyl]-1,2,4-trimethylpyrrole-3-carboxamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-5-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-oxoacetyl]-1,2,4-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146450252 |
| Molecular Formula | C19H23ClN4O4 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-5-[2-[(1-hydroxy-2-methylpropan-2-yl)amino]-2-oxoacetyl]-1,2,4-trimethylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccnc(Cl)c2)c(C)n(C)c1C(=O)C(=O)NC(C)(C)CO |
| InChI | InChI=1S/C19H23ClN4O4/c1-10-14(17(27)22-12-6-7-21-13(20)8-12)11(2)24(5)15(10)16(26)18(28)23-19(3,4)9-25/h6-8,25H,9H2,1-5H3,(H,23,28)(H,21,22,27) |
| InChIKey | HQJDNYWFZAIUBN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|