C19H18ClFN2O4 — CID 146450377
ethyl 2-[2-chloro-1-[(4-fluoro-3-methylphenyl)carbamoyl]-6,7-dihydro-5H-pyrrolizin-3-yl]-2-oxoacetate (PubChem CID 146450377) has the molecular formula C19H18ClFN2O4 and a molecular weight of 392.81 g/mol. Its IUPAC name is ethyl 2-[2-chloro-1-[(4-fluoro-3-methylphenyl)carbamoyl]-6,7-dihydro-5H-pyrrolizin-3-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[2-chloro-1-[(4-fluoro-3-methylphenyl)carbamoyl]-6,7-dihydro-5H-pyrrolizin-3-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 146450377 |
| Molecular Formula | C19H18ClFN2O4 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | ethyl 2-[2-chloro-1-[(4-fluoro-3-methylphenyl)carbamoyl]-6,7-dihydro-5H-pyrrolizin-3-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1c(Cl)c(C(=O)Nc2ccc(F)c(C)c2)c2n1CCC2 |
| InChI | InChI=1S/C19H18ClFN2O4/c1-3-27-19(26)17(24)16-15(20)14(13-5-4-8-23(13)16)18(25)22-11-6-7-12(21)10(2)9-11/h6-7,9H,3-5,8H2,1-2H3,(H,22,25) |
| InChIKey | SONOERMOOXNBOE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|