C17H15BrClFN2O4 — CID 154685483
ethyl 2-[2-bromo-5-[(3-chloro-4-fluorophenyl)carbamoyl]-1,4-dimethylpyrrol-3-yl]-2-oxoacetate (PubChem CID 154685483) has the molecular formula C17H15BrClFN2O4 and a molecular weight of 445.67 g/mol. Its IUPAC name is ethyl 2-[2-bromo-5-[(3-chloro-4-fluorophenyl)carbamoyl]-1,4-dimethylpyrrol-3-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[2-bromo-5-[(3-chloro-4-fluorophenyl)carbamoyl]-1,4-dimethylpyrrol-3-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 154685483 |
| Molecular Formula | C17H15BrClFN2O4 |
| Molecular Weight | 445.67 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | ethyl 2-[2-bromo-5-[(3-chloro-4-fluorophenyl)carbamoyl]-1,4-dimethylpyrrol-3-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1c(C)c(C(=O)Nc2ccc(F)c(Cl)c2)n(C)c1Br |
| InChI | InChI=1S/C17H15BrClFN2O4/c1-4-26-17(25)14(23)12-8(2)13(22(3)15(12)18)16(24)21-9-5-6-11(20)10(19)7-9/h5-7H,4H2,1-3H3,(H,21,24) |
| InChIKey | MBJWOWKWIMCMBN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.67 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|