C23H25FN6O3S — CID 146450440
5-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]amino]-2-oxoacetyl]-N-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-trimethylpyrrole-3-carboxamide (PubChem CID 146450440) has the molecular formula C23H25FN6O3S and a molecular weight of 484.56 g/mol. Its IUPAC name is 5-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]amino]-2-oxoacetyl]-N-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-trimethylpyrrole-3-carboxamide.
| Compound Name | 5-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]amino]-2-oxoacetyl]-N-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146450440 |
| Molecular Formula | C23H25FN6O3S |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 5-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]amino]-2-oxoacetyl]-N-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-trimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c(C)c(C(=O)C(=O)N[C@H]3CCc4nc(N)sc4C3)n(C)c2C)cnc1F |
| InChI | InChI=1S/C23H25FN6O3S/c1-10-7-14(9-26-20(10)24)28-21(32)17-11(2)18(30(4)12(17)3)19(31)22(33)27-13-5-6-15-16(8-13)34-23(25)29-15/h7,9,13H,5-6,8H2,1-4H3,(H2,25,29)(H,27,33)(H,28,32)/t13-/m0/s1 |
| InChIKey | BXDCCFITZDNQHT-ZDUSSCGKSA-N |
| XLogP | 2.63 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|