C25H27FN4O3S — CID 158564407
N-(4-fluoro-3-methylphenyl)-1,2,4-trimethyl-5-[2-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)amino]-2-oxoacetyl]pyrrole-3-carboxamide (PubChem CID 158564407) has the molecular formula C25H27FN4O3S and a molecular weight of 482.58 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-1,2,4-trimethyl-5-[2-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)amino]-2-oxoacetyl]pyrrole-3-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-1,2,4-trimethyl-5-[2-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)amino]-2-oxoacetyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 158564407 |
| Molecular Formula | C25H27FN4O3S |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-1,2,4-trimethyl-5-[2-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)amino]-2-oxoacetyl]pyrrole-3-carboxamide |
| SMILES | Cc1nc2c(s1)CC(NC(=O)C(=O)c1c(C)c(C(=O)Nc3ccc(F)c(C)c3)c(C)n1C)CC2 |
| InChI | InChI=1S/C25H27FN4O3S/c1-12-10-16(6-8-18(12)26)28-24(32)21-13(2)22(30(5)14(21)3)23(31)25(33)29-17-7-9-19-20(11-17)34-15(4)27-19/h6,8,10,17H,7,9,11H2,1-5H3,(H,28,32)(H,29,33) |
| InChIKey | NVTUCLQNJYPUCH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|