C11H10ClF3N4O6S2 — CID 146451122
N-[4-chloro-7-nitro-1-(2,2,2-trifluoroethyl)indazol-3-yl]-N-methylsulfonylmethanesulfonamide (PubChem CID 146451122) has the molecular formula C11H10ClF3N4O6S2 and a molecular weight of 450.80 g/mol. Its IUPAC name is N-[4-chloro-7-nitro-1-(2,2,2-trifluoroethyl)indazol-3-yl]-N-methylsulfonylmethanesulfonamide.
| Compound Name | N-[4-chloro-7-nitro-1-(2,2,2-trifluoroethyl)indazol-3-yl]-N-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 146451122 |
| Molecular Formula | C11H10ClF3N4O6S2 |
| Molecular Weight | 450.80 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | N-[4-chloro-7-nitro-1-(2,2,2-trifluoroethyl)indazol-3-yl]-N-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(c1nn(CC(F)(F)F)c2c([N+](=O)[O-])ccc(Cl)c12)S(C)(=O)=O |
| InChI | InChI=1S/C11H10ClF3N4O6S2/c1-26(22,23)19(27(2,24)25)10-8-6(12)3-4-7(18(20)21)9(8)17(16-10)5-11(13,14)15/h3-4H,5H2,1-2H3 |
| InChIKey | UMYIMDANVNIAOA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 132.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.80 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|