C22H25FN2O5S — CID 146454044
[(Z)-1-amino-2-[(2-butyl-1,3-benzoxazol-6-yl)oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate (PubChem CID 146454044) has the molecular formula C22H25FN2O5S and a molecular weight of 448.52 g/mol. Its IUPAC name is [(Z)-1-amino-2-[(2-butyl-1,3-benzoxazol-6-yl)oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-1-amino-2-[(2-butyl-1,3-benzoxazol-6-yl)oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 146454044 |
| Molecular Formula | C22H25FN2O5S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [(Z)-1-amino-2-[(2-butyl-1,3-benzoxazol-6-yl)oxymethyl]-3-fluoroprop-2-enyl] 4-methylbenzenesulfonate |
| SMILES | CCCCc1nc2ccc(OC/C(=C/F)C(N)OS(=O)(=O)c3ccc(C)cc3)cc2o1 |
| InChI | InChI=1S/C22H25FN2O5S/c1-3-4-5-21-25-19-11-8-17(12-20(19)29-21)28-14-16(13-23)22(24)30-31(26,27)18-9-6-15(2)7-10-18/h6-13,22H,3-5,14,24H2,1-2H3/b16-13- |
| InChIKey | XDHDTJJGXUOQCW-SSZFMOIBSA-N |
| XLogP | 4.40 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|