C27H37ClN2O3 — CID 14146352
N-butyl-N-[3-[4-[(E)-2-(6-methoxy-1,3-benzoxazol-2-yl)ethenyl]phenoxy]propyl]butan-1-amine;hydrochloride (PubChem CID 14146352) has the molecular formula C27H37ClN2O3 and a molecular weight of 473.06 g/mol. Its IUPAC name is N-butyl-N-[3-[4-[(E)-2-(6-methoxy-1,3-benzoxazol-2-yl)ethenyl]phenoxy]propyl]butan-1-amine;hydrochloride.
| Compound Name | N-butyl-N-[3-[4-[(E)-2-(6-methoxy-1,3-benzoxazol-2-yl)ethenyl]phenoxy]propyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 14146352 |
| Molecular Formula | C27H37ClN2O3 |
| Molecular Weight | 473.06 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-butyl-N-[3-[4-[(E)-2-(6-methoxy-1,3-benzoxazol-2-yl)ethenyl]phenoxy]propyl]butan-1-amine;hydrochloride |
| SMILES | CCCCN(CCCC)CCCOc1ccc(/C=C/c2nc3ccc(OC)cc3o2)cc1.Cl |
| InChI | InChI=1S/C27H36N2O3.ClH/c1-4-6-17-29(18-7-5-2)19-8-20-31-23-12-9-22(10-13-23)11-16-27-28-25-15-14-24(30-3)21-26(25)32-27;/h9-16,21H,4-8,17-20H2,1-3H3;1H/b16-11+; |
| InChIKey | PYMFLXCJGYECAJ-YFMOEUEHSA-N |
| XLogP | 7.10 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.06 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|