C10H16FNO4 — CID 146454285
methyl (Z)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate (PubChem CID 146454285) has the molecular formula C10H16FNO4 and a molecular weight of 233.24 g/mol. Its IUPAC name is methyl (Z)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate.
| Compound Name | methyl (Z)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate |
|---|---|
| PubChem CID | 146454285 |
| Molecular Formula | C10H16FNO4 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl (Z)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate |
| SMILES | COC(=O)/C(F)=C/CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H16FNO4/c1-10(2,3)16-9(14)12-6-5-7(11)8(13)15-4/h5H,6H2,1-4H3,(H,12,14)/b7-5- |
| InChIKey | WNTBQHXQEONUPA-ALCCZGGFSA-N |
| XLogP | 1.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|