C11H18FNO4 — CID 59588960
ethyl (E)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate (PubChem CID 59588960) has the molecular formula C11H18FNO4 and a molecular weight of 247.27 g/mol. Its IUPAC name is ethyl (E)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate.
| Compound Name | ethyl (E)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate |
|---|---|
| PubChem CID | 59588960 |
| Molecular Formula | C11H18FNO4 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl (E)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoate |
| SMILES | CCOC(=O)/C(F)=C\CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H18FNO4/c1-5-16-9(14)8(12)6-7-13-10(15)17-11(2,3)4/h6H,5,7H2,1-4H3,(H,13,15)/b8-6+ |
| InChIKey | GNJNXPKOEFOWLW-SOFGYWHQSA-N |
| XLogP | 1.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|