C33H32F2N6O5 — CID 146454709
1-acetyloxyethyl 7-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-5,6-difluoro-8-(methylamino)-9H-pyrido[2,3-b]indol-3-yl]-4-oxoquinolizine-3-carboxylate (PubChem CID 146454709) has the molecular formula C33H32F2N6O5 and a molecular weight of 630.65 g/mol. Its IUPAC name is 1-acetyloxyethyl 7-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-5,6-difluoro-8-(methylamino)-9H-pyrido[2,3-b]indol-3-yl]-4-oxoquinolizine-3-carboxylate.
| Compound Name | 1-acetyloxyethyl 7-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-5,6-difluoro-8-(methylamino)-9H-pyrido[2,3-b]indol-3-yl]-4-oxoquinolizine-3-carboxylate |
|---|---|
| PubChem CID | 146454709 |
| Molecular Formula | C33H32F2N6O5 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | 1-acetyloxyethyl 7-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-5,6-difluoro-8-(methylamino)-9H-pyrido[2,3-b]indol-3-yl]-4-oxoquinolizine-3-carboxylate |
| SMILES | CNc1cc(F)c(F)c2c1[nH]c1ncc(-c3ccc4ccc(C(=O)OC(C)OC(C)=O)c(=O)n4c3)c(N3CC[C@H]4CN(C)C[C@H]43)c12 |
| InChI | InChI=1S/C33H32F2N6O5/c1-16(42)45-17(2)46-33(44)21-8-7-20-6-5-18(14-41(20)32(21)43)22-12-37-31-27(26-28(35)23(34)11-24(36-3)29(26)38-31)30(22)40-10-9-19-13-39(4)15-25(19)40/h5-8,11-12,14,17,19,25,36H,9-10,13,15H2,1-4H3,(H,37,38)/t17?,19-,25+/m0/s1 |
| InChIKey | XLHRTWGGDBNGMZ-DNGAFLCXSA-N |
| XLogP | 4.52 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|