C29H25ClF2N6O3 — CID 166680808
1-chloro-7-[5,6-difluoro-4-(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)-8-(methylamino)-9H-pyrido[2,3-b]indol-3-yl]-4-oxoquinolizine-3-carboxylic acid (PubChem CID 166680808) has the molecular formula C29H25ClF2N6O3 and a molecular weight of 579.01 g/mol. Its IUPAC name is 1-chloro-7-[5,6-difluoro-4-(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)-8-(methylamino)-9H-pyrido[2,3-b]indol-3-yl]-4-oxoquinolizine-3-carboxylic acid.
| Compound Name | 1-chloro-7-[5,6-difluoro-4-(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)-8-(methylamino)-9H-pyrido[2,3-b]indol-3-yl]-4-oxoquinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 166680808 |
| Molecular Formula | C29H25ClF2N6O3 |
| Molecular Weight | 579.01 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | 1-chloro-7-[5,6-difluoro-4-(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)-8-(methylamino)-9H-pyrido[2,3-b]indol-3-yl]-4-oxoquinolizine-3-carboxylic acid |
| SMILES | CNc1cc(F)c(F)c2c1[nH]c1ncc(-c3ccc4c(Cl)cc(C(=O)O)c(=O)n4c3)c(N3CCC4CN(C)CC43)c12 |
| InChI | InChI=1S/C29H25ClF2N6O3/c1-33-19-8-18(31)24(32)22-23-26(37-6-5-14-10-36(2)12-21(14)37)16(9-34-27(23)35-25(19)22)13-3-4-20-17(30)7-15(29(40)41)28(39)38(20)11-13/h3-4,7-9,11,14,21,33H,5-6,10,12H2,1-2H3,(H,34,35)(H,40,41) |
| InChIKey | NZIGLZGGABTQBP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.01 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |