C25H23F3N6O — CID 146454964
(2,7-dimethylimidazo[1,2-b]pyridazin-3-yl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone (PubChem CID 146454964) has the molecular formula C25H23F3N6O and a molecular weight of 480.49 g/mol. Its IUPAC name is (2,7-dimethylimidazo[1,2-b]pyridazin-3-yl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone.
| Compound Name | (2,7-dimethylimidazo[1,2-b]pyridazin-3-yl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 146454964 |
| Molecular Formula | C25H23F3N6O |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (2,7-dimethylimidazo[1,2-b]pyridazin-3-yl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
| SMILES | Cc1cnn2c(C(=O)N3[C@@H]4CCC[C@H]3c3nn(C)c(-c5cc(F)c(F)c(F)c5)c3C4)c(C)nc2c1 |
| InChI | InChI=1S/C25H23F3N6O/c1-12-7-20-30-13(2)23(34(20)29-11-12)25(35)33-15-5-4-6-19(33)22-16(10-15)24(32(3)31-22)14-8-17(26)21(28)18(27)9-14/h7-9,11,15,19H,4-6,10H2,1-3H3/t15-,19+/m1/s1 |
| InChIKey | VYGUZLXROVRBEK-BEFAXECRSA-N |
| XLogP | 4.46 |
| TPSA | 68.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|