C27H25F3N6O — CID 146480820
(7-cyclopropyl-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone (PubChem CID 146480820) has the molecular formula C27H25F3N6O and a molecular weight of 506.53 g/mol. Its IUPAC name is (7-cyclopropyl-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone.
| Compound Name | (7-cyclopropyl-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 146480820 |
| Molecular Formula | C27H25F3N6O |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (7-cyclopropyl-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
| SMILES | Cc1cc2nc(C(=O)N3[C@H]4CCC[C@@H]3c3nn(C)c(-c5cc(F)c(F)c(F)c5)c3C4)cc(C3CC3)n2n1 |
| InChI | InChI=1S/C27H25F3N6O/c1-13-8-23-31-20(12-22(14-6-7-14)36(23)32-13)27(37)35-16-4-3-5-21(35)25-17(11-16)26(34(2)33-25)15-9-18(28)24(30)19(29)10-15/h8-10,12,14,16,21H,3-7,11H2,1-2H3/t16-,21+/m0/s1 |
| InChIKey | HWMBLPHBACRLRY-HRAATJIYSA-N |
| XLogP | 5.03 |
| TPSA | 68.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|