C25H22Cl2N6O — CID 146455070
[(1S,8R)-5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[2-chloro-5-(1,2,4-triazol-4-yl)phenyl]methanone (PubChem CID 146455070) has the molecular formula C25H22Cl2N6O and a molecular weight of 493.40 g/mol. Its IUPAC name is [(1S,8R)-5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[2-chloro-5-(1,2,4-triazol-4-yl)phenyl]methanone.
| Compound Name | [(1S,8R)-5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[2-chloro-5-(1,2,4-triazol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 146455070 |
| Molecular Formula | C25H22Cl2N6O |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | [(1S,8R)-5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[2-chloro-5-(1,2,4-triazol-4-yl)phenyl]methanone |
| SMILES | Cn1nc2c(c1-c1cccc(Cl)c1)C[C@H]1CCC[C@@H]2N1C(=O)c1cc(-n2cnnc2)ccc1Cl |
| InChI | InChI=1S/C25H22Cl2N6O/c1-31-24(15-4-2-5-16(26)10-15)20-12-18-6-3-7-22(23(20)30-31)33(18)25(34)19-11-17(8-9-21(19)27)32-13-28-29-14-32/h2,4-5,8-11,13-14,18,22H,3,6-7,12H2,1H3/t18-,22+/m1/s1 |
| InChIKey | XWDGISPRYNTBPG-GCJKJVERSA-N |
| XLogP | 5.27 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |