C9H6N2O2 — CID 146455224
2,3-dideuterioquinoxaline-6-carboxylic acid (PubChem CID 146455224) has the molecular formula C9H6N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2,3-dideuterioquinoxaline-6-carboxylic acid.
| Compound Name | 2,3-dideuterioquinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 146455224 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2,3-dideuterioquinoxaline-6-carboxylic acid |
| SMILES | [2H]c1nc2ccc(C(=O)O)cc2nc1[2H] |
| InChI | InChI=1S/C9H6N2O2/c12-9(13)6-1-2-7-8(5-6)11-4-3-10-7/h1-5H,(H,12,13)/i3D,4D |
| InChIKey | JGQDBVXRYDEWGM-NMQOAUCRSA-N |
| XLogP | 1.33 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |