C24H18F9N3O4 — CID 146456823
[(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[2-(trifluoromethoxy)phenyl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 146456823) has the molecular formula C24H18F9N3O4 and a molecular weight of 583.41 g/mol. Its IUPAC name is [(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[2-(trifluoromethoxy)phenyl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[2-(trifluoromethoxy)phenyl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146456823 |
| Molecular Formula | C24H18F9N3O4 |
| Molecular Weight | 583.41 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | [(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[2-(trifluoromethoxy)phenyl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | C[C@H]1c2nn(C)c(-c3cc(F)c(F)c(F)c3)c2CCN1C(=O)c1ccccc1OC(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H17F6N3O2.C2HF3O2/c1-11-19-14(20(30(2)29-19)12-9-15(23)18(25)16(24)10-12)7-8-31(11)21(32)13-5-3-4-6-17(13)33-22(26,27)28;3-2(4,5)1(6)7/h3-6,9-11H,7-8H2,1-2H3;(H,6,7)/t11-;/m0./s1 |
| InChIKey | WJHMDPKPKIUPAN-MERQFXBCSA-N |
| XLogP | 5.80 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|