C24H19F3N4O — CID 146457069
[2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-quinolin-8-ylmethanone (PubChem CID 146457069) has the molecular formula C24H19F3N4O and a molecular weight of 436.44 g/mol. Its IUPAC name is [2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-quinolin-8-ylmethanone.
| Compound Name | [2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-quinolin-8-ylmethanone |
|---|---|
| PubChem CID | 146457069 |
| Molecular Formula | C24H19F3N4O |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-quinolin-8-ylmethanone |
| SMILES | CC1c2nn(C)c(-c3cc(F)c(F)c(F)c3)c2CCN1C(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C24H19F3N4O/c1-13-21-16(23(30(2)29-21)15-11-18(25)20(27)19(26)12-15)8-10-31(13)24(32)17-7-3-5-14-6-4-9-28-22(14)17/h3-7,9,11-13H,8,10H2,1-2H3 |
| InChIKey | UVIYGJQIRWFZOJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|