C21H19F3N7O+ — CID 170521861
[(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(2-methyltriazolo[1,5-b]pyridazin-2-ium-3-yl)methanone (PubChem CID 170521861) has the molecular formula C21H19F3N7O+ and a molecular weight of 442.43 g/mol. Its IUPAC name is [(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(2-methyltriazolo[1,5-b]pyridazin-2-ium-3-yl)methanone.
| Compound Name | [(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(2-methyltriazolo[1,5-b]pyridazin-2-ium-3-yl)methanone |
|---|---|
| PubChem CID | 170521861 |
| Molecular Formula | C21H19F3N7O+ |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(2-methyltriazolo[1,5-b]pyridazin-2-ium-3-yl)methanone |
| SMILES | C[C@H]1c2nn(C)c(-c3cc(F)c(F)c(F)c3)c2CCN1C(=O)c1c2cccnn2n[n+]1C |
| InChI | InChI=1S/C21H19F3N7O/c1-11-18-13(19(28(2)26-18)12-9-14(22)17(24)15(23)10-12)6-8-30(11)21(32)20-16-5-4-7-25-31(16)27-29(20)3/h4-5,7,9-11H,6,8H2,1-3H3/q+1/t11-/m0/s1 |
| InChIKey | JQBWLFRLTGUMJG-NSHDSACASA-N |
| XLogP | 2.13 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|