C9H10N2O2 — CID 146457128
6,8-dihydro-5H-pyrano[3,4-b]pyridine-2-carboxamide (PubChem CID 146457128) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 6,8-dihydro-5H-pyrano[3,4-b]pyridine-2-carboxamide.
| Compound Name | 6,8-dihydro-5H-pyrano[3,4-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146457128 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 6,8-dihydro-5H-pyrano[3,4-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc2c(n1)COCC2 |
| InChI | InChI=1S/C9H10N2O2/c10-9(12)7-2-1-6-3-4-13-5-8(6)11-7/h1-2H,3-5H2,(H2,10,12) |
| InChIKey | ULWSAPZFLHIRGW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |