C19H31NO2 — CID 146457151
4-(tridecylamino)cyclohexa-3,5-diene-1,2-dione (PubChem CID 146457151) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 4-(tridecylamino)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-(tridecylamino)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 146457151 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 4-(tridecylamino)cyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCCCCCCCCCCNC1=CC(=O)C(=O)C=C1 |
| InChI | InChI=1S/C19H31NO2/c1-2-3-4-5-6-7-8-9-10-11-12-15-20-17-13-14-18(21)19(22)16-17/h13-14,16,20H,2-12,15H2,1H3 |
| InChIKey | KTANNVPACQZOIO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|