C10H15Cl2FN2O — CID 146457373
cyclopropyl-(5-fluoro-4-methoxy-2-pyridinyl)methanamine;dihydrochloride (PubChem CID 146457373) has the molecular formula C10H15Cl2FN2O and a molecular weight of 269.15 g/mol. Its IUPAC name is cyclopropyl-(5-fluoro-4-methoxy-2-pyridinyl)methanamine;dihydrochloride.
| Compound Name | cyclopropyl-(5-fluoro-4-methoxy-2-pyridinyl)methanamine;dihydrochloride |
|---|---|
| PubChem CID | 146457373 |
| Molecular Formula | C10H15Cl2FN2O |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | cyclopropyl-(5-fluoro-4-methoxy-2-pyridinyl)methanamine;dihydrochloride |
| SMILES | COc1cc(C(N)C2CC2)ncc1F.Cl.Cl |
| InChI | InChI=1S/C10H13FN2O.2ClH/c1-14-9-4-8(13-5-7(9)11)10(12)6-2-3-6;;/h4-6,10H,2-3,12H2,1H3;2*1H |
| InChIKey | ZECSCQHUXPDKHN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |