About 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde
2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde (PubChem CID 146460502) has the molecular formula C12H15ClO5
and a molecular weight of 274.70 g/mol. Its IUPAC name is 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde |
| PubChem CID | 146460502 |
| Molecular Formula | C12H15ClO5 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde |
| SMILES | COCOc1ccc(Cl)c(OCOC)c1CC=O |
| InChI | InChI=1S/C12H15ClO5/c1-15-7-17-11-4-3-10(13)12(18-8-16-2)9(11)5-6-14/h3-4,6H,5,7-8H2,1-2H3 |
| InChIKey | DNUVTIXMBNJCKX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde?
The IUPAC name of 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde (CID 146460502) is 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde.
What is the SMILES notation for 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde?
The canonical SMILES for 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde is COCOc1ccc(Cl)c(OCOC)c1CC=O.
What is the InChIKey of 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde?
The InChIKey is DNUVTIXMBNJCKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClO5/c1-15-7-17-11-4-3-10(13)12(18-8-16-2)9(11)5-6-14/h3-4,6H,5,7-8H2,1-2H3.
What are the key properties of 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde?
2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde has a molecular weight of 274.70 g/mol, XLogP of 2.05, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-chloro-2,6-bis(methoxymethoxy)phenyl]acetaldehyde is sourced from PubChem (CID 146460502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).