C18H14F3N3OS — CID 146461222
N-(3-methylphenyl)-4-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methyl]benzenecarbothioamide (PubChem CID 146461222) has the molecular formula C18H14F3N3OS and a molecular weight of 377.39 g/mol. Its IUPAC name is N-(3-methylphenyl)-4-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methyl]benzenecarbothioamide.
| Compound Name | N-(3-methylphenyl)-4-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 146461222 |
| Molecular Formula | C18H14F3N3OS |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-(3-methylphenyl)-4-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methyl]benzenecarbothioamide |
| SMILES | Cc1cccc(NC(=S)c2ccc(Cc3noc(C(F)(F)F)n3)cc2)c1 |
| InChI | InChI=1S/C18H14F3N3OS/c1-11-3-2-4-14(9-11)22-16(26)13-7-5-12(6-8-13)10-15-23-17(25-24-15)18(19,20)21/h2-9H,10H2,1H3,(H,22,26) |
| InChIKey | PDHSJAIADUMUIB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|