C14H15BrF3N3O — CID 166977158
3-bromo-N-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentyl]aniline (PubChem CID 166977158) has the molecular formula C14H15BrF3N3O and a molecular weight of 378.19 g/mol. Its IUPAC name is 3-bromo-N-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentyl]aniline.
| Compound Name | 3-bromo-N-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentyl]aniline |
|---|---|
| PubChem CID | 166977158 |
| Molecular Formula | C14H15BrF3N3O |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 3-bromo-N-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentyl]aniline |
| SMILES | FC(F)(F)c1nc(CCCCCNc2cccc(Br)c2)no1 |
| InChI | InChI=1S/C14H15BrF3N3O/c15-10-5-4-6-11(9-10)19-8-3-1-2-7-12-20-13(22-21-12)14(16,17)18/h4-6,9,19H,1-3,7-8H2 |
| InChIKey | FBUKOIWTACWPAX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|