C23H30N4O2 — CID 167077782
N-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentyl]-3-(3-cyclopropyl-1,2-oxazol-5-yl)aniline (PubChem CID 167077782) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentyl]-3-(3-cyclopropyl-1,2-oxazol-5-yl)aniline.
| Compound Name | N-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentyl]-3-(3-cyclopropyl-1,2-oxazol-5-yl)aniline |
|---|---|
| PubChem CID | 167077782 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentyl]-3-(3-cyclopropyl-1,2-oxazol-5-yl)aniline |
| SMILES | CC(C)(C)c1nc(CCCCCNc2cccc(-c3cc(C4CC4)no3)c2)no1 |
| InChI | InChI=1S/C23H30N4O2/c1-23(2,3)22-25-21(27-29-22)10-5-4-6-13-24-18-9-7-8-17(14-18)20-15-19(26-28-20)16-11-12-16/h7-9,14-16,24H,4-6,10-13H2,1-3H3 |
| InChIKey | QIMRPVLJMHBQKB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|