C27H35N3S — CID 154683851
N-[5-(3-cyclopropyl-1-methylpyrazol-5-yl)pentyl]-3-(4-methylsulfanylphenyl)aniline;ethene (PubChem CID 154683851) has the molecular formula C27H35N3S and a molecular weight of 433.67 g/mol. Its IUPAC name is N-[5-(3-cyclopropyl-1-methylpyrazol-5-yl)pentyl]-3-(4-methylsulfanylphenyl)aniline;ethene.
| Compound Name | N-[5-(3-cyclopropyl-1-methylpyrazol-5-yl)pentyl]-3-(4-methylsulfanylphenyl)aniline;ethene |
|---|---|
| PubChem CID | 154683851 |
| Molecular Formula | C27H35N3S |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | N-[5-(3-cyclopropyl-1-methylpyrazol-5-yl)pentyl]-3-(4-methylsulfanylphenyl)aniline;ethene |
| SMILES | C=C.CSc1ccc(-c2cccc(NCCCCCc3cc(C4CC4)nn3C)c2)cc1 |
| InChI | InChI=1S/C25H31N3S.C2H4/c1-28-23(18-25(27-28)20-10-11-20)9-4-3-5-16-26-22-8-6-7-21(17-22)19-12-14-24(29-2)15-13-19;1-2/h6-8,12-15,17-18,20,26H,3-5,9-11,16H2,1-2H3;1-2H2 |
| InChIKey | OZPCOMBXQCTSLN-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|