C18H17F2N3S — CID 19886117
4-[3-(difluoromethyl)-5-(4-methylsulfanylphenyl)pyrazol-1-yl]-N-methylaniline (PubChem CID 19886117) has the molecular formula C18H17F2N3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-[3-(difluoromethyl)-5-(4-methylsulfanylphenyl)pyrazol-1-yl]-N-methylaniline.
| Compound Name | 4-[3-(difluoromethyl)-5-(4-methylsulfanylphenyl)pyrazol-1-yl]-N-methylaniline |
|---|---|
| PubChem CID | 19886117 |
| Molecular Formula | C18H17F2N3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-[3-(difluoromethyl)-5-(4-methylsulfanylphenyl)pyrazol-1-yl]-N-methylaniline |
| SMILES | CNc1ccc(-n2nc(C(F)F)cc2-c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C18H17F2N3S/c1-21-13-5-7-14(8-6-13)23-17(11-16(22-23)18(19)20)12-3-9-15(24-2)10-4-12/h3-11,18,21H,1-2H3 |
| InChIKey | CXURJGWRYOLZFU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |