C24H32N4O3S — CID 166977321
N-[4-[3-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentylamino]phenyl]phenyl]methanesulfonamide (PubChem CID 166977321) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is N-[4-[3-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentylamino]phenyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[3-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentylamino]phenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 166977321 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-[4-[3-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentylamino]phenyl]phenyl]methanesulfonamide |
| SMILES | CC(C)(C)c1nc(CCCCCNc2cccc(-c3ccc(NS(C)(=O)=O)cc3)c2)no1 |
| InChI | InChI=1S/C24H32N4O3S/c1-24(2,3)23-26-22(27-31-23)11-6-5-7-16-25-21-10-8-9-19(17-21)18-12-14-20(15-13-18)28-32(4,29)30/h8-10,12-15,17,25,28H,5-7,11,16H2,1-4H3 |
| InChIKey | QZMSTBPBMSHAQK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|