C29H37FN4O4S — CID 166977355
N-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentyl]-4-fluoro-N-[3-[4-(methanesulfonamido)phenyl]phenyl]pent-4-enamide (PubChem CID 166977355) has the molecular formula C29H37FN4O4S and a molecular weight of 556.70 g/mol. Its IUPAC name is N-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentyl]-4-fluoro-N-[3-[4-(methanesulfonamido)phenyl]phenyl]pent-4-enamide.
| Compound Name | N-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentyl]-4-fluoro-N-[3-[4-(methanesulfonamido)phenyl]phenyl]pent-4-enamide |
|---|---|
| PubChem CID | 166977355 |
| Molecular Formula | C29H37FN4O4S |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | N-[5-(5-tert-butyl-1,2,4-oxadiazol-3-yl)pentyl]-4-fluoro-N-[3-[4-(methanesulfonamido)phenyl]phenyl]pent-4-enamide |
| SMILES | C=C(F)CCC(=O)N(CCCCCc1noc(C(C)(C)C)n1)c1cccc(-c2ccc(NS(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C29H37FN4O4S/c1-21(30)13-18-27(35)34(19-8-6-7-12-26-31-28(38-32-26)29(2,3)4)25-11-9-10-23(20-25)22-14-16-24(17-15-22)33-39(5,36)37/h9-11,14-17,20,33H,1,6-8,12-13,18-19H2,2-5H3 |
| InChIKey | BRVDWUCSBPBBID-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|