C30H32F2N4O2 — CID 154682993
N-[3-(3-cyano-4-fluorophenyl)phenyl]-N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoropent-4-enamide;ethene (PubChem CID 154682993) has the molecular formula C30H32F2N4O2 and a molecular weight of 518.61 g/mol. Its IUPAC name is N-[3-(3-cyano-4-fluorophenyl)phenyl]-N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoropent-4-enamide;ethene.
| Compound Name | N-[3-(3-cyano-4-fluorophenyl)phenyl]-N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoropent-4-enamide;ethene |
|---|---|
| PubChem CID | 154682993 |
| Molecular Formula | C30H32F2N4O2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-[3-(3-cyano-4-fluorophenyl)phenyl]-N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoropent-4-enamide;ethene |
| SMILES | C=C.C=C(F)CCC(=O)N(CCCCCc1nc(C2CC2)no1)c1cccc(-c2ccc(F)c(C#N)c2)c1 |
| InChI | InChI=1S/C28H28F2N4O2.C2H4/c1-19(29)9-14-27(35)34(15-4-2-3-8-26-32-28(33-36-26)20-10-11-20)24-7-5-6-21(17-24)22-12-13-25(30)23(16-22)18-31;1-2/h5-7,12-13,16-17,20H,1-4,8-11,14-15H2;1-2H2 |
| InChIKey | BTAMZDPVTMBBCD-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 83.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|