C26H29FN6O2 — CID 155063988
N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(4-cyclopropyltriazol-1-yl)phenyl]-5-fluoropent-4-ynamide (PubChem CID 155063988) has the molecular formula C26H29FN6O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(4-cyclopropyltriazol-1-yl)phenyl]-5-fluoropent-4-ynamide.
| Compound Name | N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(4-cyclopropyltriazol-1-yl)phenyl]-5-fluoropent-4-ynamide |
|---|---|
| PubChem CID | 155063988 |
| Molecular Formula | C26H29FN6O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-N-[3-(4-cyclopropyltriazol-1-yl)phenyl]-5-fluoropent-4-ynamide |
| SMILES | O=C(CCC#CF)N(CCCCCc1nc(C2CC2)no1)c1cccc(-n2cc(C3CC3)nn2)c1 |
| InChI | InChI=1S/C26H29FN6O2/c27-15-4-3-10-25(34)32(16-5-1-2-9-24-28-26(30-35-24)20-13-14-20)21-7-6-8-22(17-21)33-18-23(29-31-33)19-11-12-19/h6-8,17-20H,1-3,5,9-14,16H2 |
| InChIKey | LXCUBYNMSOPDCF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 89.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|