C26H27F4N5O2 — CID 166977203
N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoro-2-methylidene-N-[3-[2-(trifluoromethyl)pyrimidin-5-yl]phenyl]butanamide (PubChem CID 166977203) has the molecular formula C26H27F4N5O2 and a molecular weight of 517.53 g/mol. Its IUPAC name is N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoro-2-methylidene-N-[3-[2-(trifluoromethyl)pyrimidin-5-yl]phenyl]butanamide.
| Compound Name | N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoro-2-methylidene-N-[3-[2-(trifluoromethyl)pyrimidin-5-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 166977203 |
| Molecular Formula | C26H27F4N5O2 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | N-[5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoro-2-methylidene-N-[3-[2-(trifluoromethyl)pyrimidin-5-yl]phenyl]butanamide |
| SMILES | C=C(CCF)C(=O)N(CCCCCc1nc(C2CC2)no1)c1cccc(-c2cnc(C(F)(F)F)nc2)c1 |
| InChI | InChI=1S/C26H27F4N5O2/c1-17(11-12-27)24(36)35(13-4-2-3-8-22-33-23(34-37-22)18-9-10-18)21-7-5-6-19(14-21)20-15-31-25(32-16-20)26(28,29)30/h5-7,14-16,18H,1-4,8-13H2 |
| InChIKey | LWCKBFATNVXQAO-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 85.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|