C29H30F3N5O2S — CID 166977342
N-[3-(2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridin-6-yl)phenyl]-N-[5-[5-(1,1-difluoroethyl)-1,2,4-oxadiazol-3-yl]pentyl]-4-fluoro-2-methylidenebutanamide (PubChem CID 166977342) has the molecular formula C29H30F3N5O2S and a molecular weight of 569.65 g/mol. Its IUPAC name is N-[3-(2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridin-6-yl)phenyl]-N-[5-[5-(1,1-difluoroethyl)-1,2,4-oxadiazol-3-yl]pentyl]-4-fluoro-2-methylidenebutanamide.
| Compound Name | N-[3-(2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridin-6-yl)phenyl]-N-[5-[5-(1,1-difluoroethyl)-1,2,4-oxadiazol-3-yl]pentyl]-4-fluoro-2-methylidenebutanamide |
|---|---|
| PubChem CID | 166977342 |
| Molecular Formula | C29H30F3N5O2S |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | N-[3-(2-cyclopropyl-[1,3]thiazolo[4,5-b]pyridin-6-yl)phenyl]-N-[5-[5-(1,1-difluoroethyl)-1,2,4-oxadiazol-3-yl]pentyl]-4-fluoro-2-methylidenebutanamide |
| SMILES | C=C(CCF)C(=O)N(CCCCCc1noc(C(C)(F)F)n1)c1cccc(-c2cnc3nc(C4CC4)sc3c2)c1 |
| InChI | InChI=1S/C29H30F3N5O2S/c1-18(12-13-30)27(38)37(14-5-3-4-9-24-34-28(39-36-24)29(2,31)32)22-8-6-7-20(15-22)21-16-23-25(33-17-21)35-26(40-23)19-10-11-19/h6-8,15-17,19H,1,3-5,9-14H2,2H3 |
| InChIKey | LLXGPBJYVFGMOL-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 85.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|