C22H26FN3O4 — CID 154683389
6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-N-(4-fluoro-2-methylidenebutanoyl)anilino]hexanoic acid (PubChem CID 154683389) has the molecular formula C22H26FN3O4 and a molecular weight of 415.47 g/mol. Its IUPAC name is 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-N-(4-fluoro-2-methylidenebutanoyl)anilino]hexanoic acid.
| Compound Name | 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-N-(4-fluoro-2-methylidenebutanoyl)anilino]hexanoic acid |
|---|---|
| PubChem CID | 154683389 |
| Molecular Formula | C22H26FN3O4 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 6-[3-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-N-(4-fluoro-2-methylidenebutanoyl)anilino]hexanoic acid |
| SMILES | C=C(CCF)C(=O)N(CCCCCC(=O)O)c1cccc(-c2nnc(C3CC3)o2)c1 |
| InChI | InChI=1S/C22H26FN3O4/c1-15(11-12-23)22(29)26(13-4-2-3-8-19(27)28)18-7-5-6-17(14-18)21-25-24-20(30-21)16-9-10-16/h5-7,14,16H,1-4,8-13H2,(H,27,28) |
| InChIKey | NYGSYJQLLVZZTN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|